C22H14F8O4 — CID 101178832
[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pent-4-enoyloxyphenyl)phenyl] pent-4-enoate (PubChem CID 101178832) has the molecular formula C22H14F8O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pent-4-enoyloxyphenyl)phenyl] pent-4-enoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pent-4-enoyloxyphenyl)phenyl] pent-4-enoate |
|---|---|
| PubChem CID | 101178832 |
| Molecular Formula | C22H14F8O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pent-4-enoyloxyphenyl)phenyl] pent-4-enoate |
| SMILES | C=CCCC(=O)Oc1c(F)c(F)c(-c2c(F)c(F)c(OC(=O)CCC=C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H14F8O4/c1-3-5-7-9(31)33-21-17(27)13(23)11(14(24)18(21)28)12-15(25)19(29)22(20(30)16(12)26)34-10(32)8-6-4-2/h3-4H,1-2,5-8H2 |
| InChIKey | YMQRFVILODFCLI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|