About aminomethyl pent-4-enoate
aminomethyl pent-4-enoate (PubChem CID 123806014) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is aminomethyl pent-4-enoate.
Molecular Properties
| Compound Name | aminomethyl pent-4-enoate |
| PubChem CID | 123806014 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | aminomethyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCN |
| InChI | InChI=1S/C6H11NO2/c1-2-3-4-6(8)9-5-7/h2H,1,3-5,7H2 |
| InChIKey | RDXWPQCBMYKTOR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze aminomethyl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethyl pent-4-enoate?
The IUPAC name of aminomethyl pent-4-enoate (CID 123806014) is aminomethyl pent-4-enoate.
What is the SMILES notation for aminomethyl pent-4-enoate?
The canonical SMILES for aminomethyl pent-4-enoate is C=CCCC(=O)OCN.
What is the InChIKey of aminomethyl pent-4-enoate?
The InChIKey is RDXWPQCBMYKTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-3-4-6(8)9-5-7/h2H,1,3-5,7H2.
What are the key properties of aminomethyl pent-4-enoate?
aminomethyl pent-4-enoate has a molecular weight of 129.16 g/mol, XLogP of 0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethyl pent-4-enoate is sourced from PubChem (CID 123806014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).