C13H21NO3 — CID 6709762
[(2R)-2-(pent-4-enoylamino)propyl] pent-4-enoate (PubChem CID 6709762) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is [(2R)-2-(pent-4-enoylamino)propyl] pent-4-enoate.
| Compound Name | [(2R)-2-(pent-4-enoylamino)propyl] pent-4-enoate |
|---|---|
| PubChem CID | 6709762 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [(2R)-2-(pent-4-enoylamino)propyl] pent-4-enoate |
| SMILES | C=CCCC(=O)N[C@H](C)COC(=O)CCC=C |
| InChI | InChI=1S/C13H21NO3/c1-4-6-8-12(15)14-11(3)10-17-13(16)9-7-5-2/h4-5,11H,1-2,6-10H2,3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | KYFACUIDJBPISI-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|