C14H23NO3 — CID 118867085
[(2S)-2-(pent-4-enoylamino)propyl] (2R)-2-methylpent-4-enoate (PubChem CID 118867085) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [(2S)-2-(pent-4-enoylamino)propyl] (2R)-2-methylpent-4-enoate.
| Compound Name | [(2S)-2-(pent-4-enoylamino)propyl] (2R)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 118867085 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [(2S)-2-(pent-4-enoylamino)propyl] (2R)-2-methylpent-4-enoate |
| SMILES | C=CCCC(=O)N[C@@H](C)COC(=O)[C@H](C)CC=C |
| InChI | InChI=1S/C14H23NO3/c1-5-7-9-13(16)15-12(4)10-18-14(17)11(3)8-6-2/h5-6,11-12H,1-2,7-10H2,3-4H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | CVDKCNDIKMKAHQ-NEPJUHHUSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|