C20H27NO3 — CID 118867115
[2-(4-methylpent-4-enoylamino)-2-phenylethyl] 2-methylpent-4-enoate (PubChem CID 118867115) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [2-(4-methylpent-4-enoylamino)-2-phenylethyl] 2-methylpent-4-enoate.
| Compound Name | [2-(4-methylpent-4-enoylamino)-2-phenylethyl] 2-methylpent-4-enoate |
|---|---|
| PubChem CID | 118867115 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [2-(4-methylpent-4-enoylamino)-2-phenylethyl] 2-methylpent-4-enoate |
| SMILES | C=CCC(C)C(=O)OCC(NC(=O)CCC(=C)C)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-5-9-16(4)20(23)24-14-18(17-10-7-6-8-11-17)21-19(22)13-12-15(2)3/h5-8,10-11,16,18H,1-2,9,12-14H2,3-4H3,(H,21,22) |
| InChIKey | COAKQJVZQGYYCY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|