C24H33NO5 — CID 67310391
4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] (2S)-2-prop-2-enylbutanedioate (PubChem CID 67310391) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] (2S)-2-prop-2-enylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] (2S)-2-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 67310391 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] (2S)-2-prop-2-enylbutanedioate |
| SMILES | C=CCCC(=O)N[C@@H](COC(=O)[C@@H](CC=C)CC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO5/c1-6-8-15-21(26)25-20(18-13-10-9-11-14-18)17-29-23(28)19(12-7-2)16-22(27)30-24(3,4)5/h6-7,9-11,13-14,19-20H,1-2,8,12,15-17H2,3-5H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | HWDCKIYJKURLBK-PMACEKPBSA-N |
| XLogP | 4.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|