C22H37NO5 — CID 118867325
4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)hexyl] (2S)-2-prop-2-enylbutanedioate (PubChem CID 118867325) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)hexyl] (2S)-2-prop-2-enylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)hexyl] (2S)-2-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 118867325 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(2R)-2-(pent-4-enoylamino)hexyl] (2S)-2-prop-2-enylbutanedioate |
| SMILES | C=CCCC(=O)N[C@H](CCCC)COC(=O)C(CC=C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO5/c1-7-10-13-18(23-19(24)14-11-8-2)16-27-21(26)17(12-9-3)15-20(25)28-22(4,5)6/h8-9,17-18H,2-3,7,10-16H2,1,4-6H3,(H,23,24)/t17?,18-/m1/s1 |
| InChIKey | CQBBUOYZNIAVNQ-QRWMCTBCSA-N |
| XLogP | 4.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|