C16H27NO6 — CID 142073207
tert-butyl 3-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)carbamoyl]hex-5-enoate (PubChem CID 142073207) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl 3-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)carbamoyl]hex-5-enoate.
| Compound Name | tert-butyl 3-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)carbamoyl]hex-5-enoate |
|---|---|
| PubChem CID | 142073207 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl 3-[(1-ethoxy-3-hydroxy-1-oxopropan-2-yl)carbamoyl]hex-5-enoate |
| SMILES | C=CCC(CC(=O)OC(C)(C)C)C(=O)NC(CO)C(=O)OCC |
| InChI | InChI=1S/C16H27NO6/c1-6-8-11(9-13(19)23-16(3,4)5)14(20)17-12(10-18)15(21)22-7-2/h6,11-12,18H,1,7-10H2,2-5H3,(H,17,20) |
| InChIKey | PLFIKERZCDDGHK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|