C8H17ClN2O5 — CID 156620479
ethyl 2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoate;hydrochloride (PubChem CID 156620479) has the molecular formula C8H17ClN2O5 and a molecular weight of 256.69 g/mol. Its IUPAC name is ethyl 2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoate;hydrochloride.
| Compound Name | ethyl 2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoate;hydrochloride |
|---|---|
| PubChem CID | 156620479 |
| Molecular Formula | C8H17ClN2O5 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | ethyl 2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoate;hydrochloride |
| SMILES | CCOC(=O)C(CO)NC(=O)C(N)CO.Cl |
| InChI | InChI=1S/C8H16N2O5.ClH/c1-2-15-8(14)6(4-12)10-7(13)5(9)3-11;/h5-6,11-12H,2-4,9H2,1H3,(H,10,13);1H |
| InChIKey | UBQHXTQPQCQDOV-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |