C7H14N2O4 — CID 138527125
2-amino-3-hydroxy-N-(1-hydroxy-3-oxobutan-2-yl)propanamide (PubChem CID 138527125) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-amino-3-hydroxy-N-(1-hydroxy-3-oxobutan-2-yl)propanamide.
| Compound Name | 2-amino-3-hydroxy-N-(1-hydroxy-3-oxobutan-2-yl)propanamide |
|---|---|
| PubChem CID | 138527125 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-amino-3-hydroxy-N-(1-hydroxy-3-oxobutan-2-yl)propanamide |
| SMILES | CC(=O)C(CO)NC(=O)C(N)CO |
| InChI | InChI=1S/C7H14N2O4/c1-4(12)6(3-11)9-7(13)5(8)2-10/h5-6,10-11H,2-3,8H2,1H3,(H,9,13) |
| InChIKey | NHNRRDKYOMBRBZ-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |