C15H26N2O5 — CID 54393368
ethyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate (PubChem CID 54393368) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 54393368 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate |
| SMILES | C=CC[C@@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C15H26N2O5/c1-7-9-11(17-14(20)22-15(4,5)6)12(18)16-10(3)13(19)21-8-2/h7,10-11H,1,8-9H2,2-6H3,(H,16,18)(H,17,20)/t10-,11+/m0/s1 |
| InChIKey | VIFNRCABOYCMRX-WDEREUQCSA-N |
| XLogP | 1.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|