C24H33NO5 — CID 118867349
4-O-(2-methylpropyl) 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] 2-prop-2-enylbutanedioate (PubChem CID 118867349) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-O-(2-methylpropyl) 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] 2-prop-2-enylbutanedioate.
| Compound Name | 4-O-(2-methylpropyl) 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] 2-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 118867349 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-O-(2-methylpropyl) 1-O-[(2R)-2-(pent-4-enoylamino)-2-phenylethyl] 2-prop-2-enylbutanedioate |
| SMILES | C=CCCC(=O)N[C@@H](COC(=O)C(CC=C)CC(=O)OCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO5/c1-5-7-14-22(26)25-21(19-12-9-8-10-13-19)17-30-24(28)20(11-6-2)15-23(27)29-16-18(3)4/h5-6,8-10,12-13,18,20-21H,1-2,7,11,14-17H2,3-4H3,(H,25,26)/t20?,21-/m0/s1 |
| InChIKey | NXCCLNFJMBVOIL-LBAQZLPGSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|