C24H32FNO5 — CID 118867185
1-O-[(2S)-2-(4-fluorophenyl)-2-(pent-4-enoylamino)ethyl] 4-O-(2-methylpropyl) 2-prop-2-enylbutanedioate (PubChem CID 118867185) has the molecular formula C24H32FNO5 and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-O-[(2S)-2-(4-fluorophenyl)-2-(pent-4-enoylamino)ethyl] 4-O-(2-methylpropyl) 2-prop-2-enylbutanedioate.
| Compound Name | 1-O-[(2S)-2-(4-fluorophenyl)-2-(pent-4-enoylamino)ethyl] 4-O-(2-methylpropyl) 2-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 118867185 |
| Molecular Formula | C24H32FNO5 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-O-[(2S)-2-(4-fluorophenyl)-2-(pent-4-enoylamino)ethyl] 4-O-(2-methylpropyl) 2-prop-2-enylbutanedioate |
| SMILES | C=CCCC(=O)N[C@H](COC(=O)C(CC=C)CC(=O)OCC(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FNO5/c1-5-7-9-22(27)26-21(18-10-12-20(25)13-11-18)16-31-24(29)19(8-6-2)14-23(28)30-15-17(3)4/h5-6,10-13,17,19,21H,1-2,7-9,14-16H2,3-4H3,(H,26,27)/t19?,21-/m1/s1 |
| InChIKey | VIMGJMCCIYZNQX-VGAJERRHSA-N |
| XLogP | 4.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|