C16H19NO5 — CID 126492389
1-O-methyl 4-O-[(2S)-2-phenyl-2-(propanoylamino)ethyl] (E)-but-2-enedioate (PubChem CID 126492389) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2S)-2-phenyl-2-(propanoylamino)ethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2S)-2-phenyl-2-(propanoylamino)ethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492389 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-O-methyl 4-O-[(2S)-2-phenyl-2-(propanoylamino)ethyl] (E)-but-2-enedioate |
| SMILES | CCC(=O)N[C@H](COC(=O)/C=C/C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H19NO5/c1-3-14(18)17-13(12-7-5-4-6-8-12)11-22-16(20)10-9-15(19)21-2/h4-10,13H,3,11H2,1-2H3,(H,17,18)/b10-9+/t13-/m1/s1 |
| InChIKey | WJCUUEWPSORHBI-WTNCMQEWSA-N |
| XLogP | 1.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|