About [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate
[(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate (PubChem CID 101078959) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate.
Molecular Properties
| Compound Name | [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate |
| PubChem CID | 101078959 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate |
| SMILES | C=CCCC(=O)N[C@H](COC(=O)CCC=C)C(C)CC |
| InChI | InChI=1S/C16H27NO3/c1-5-8-10-15(18)17-14(13(4)7-3)12-20-16(19)11-9-6-2/h5-6,13-14H,1-2,7-12H2,3-4H3,(H,17,18)/t13?,14-/m1/s1 |
| InChIKey | YJFCRQSCNHAAEE-ARLHGKGLSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate?
The IUPAC name of [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate (CID 101078959) is [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate.
What is the SMILES notation for [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate?
The canonical SMILES for [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate is C=CCCC(=O)N[C@H](COC(=O)CCC=C)C(C)CC.
What is the InChIKey of [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate?
The InChIKey is YJFCRQSCNHAAEE-ARLHGKGLSA-N. The full InChI is InChI=1S/C16H27NO3/c1-5-8-10-15(18)17-14(13(4)7-3)12-20-16(19)11-9-6-2/h5-6,13-14H,1-2,7-12H2,3-4H3,(H,17,18)/t13?,14-/m1/s1.
What are the key properties of [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate?
[(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate has a molecular weight of 281.40 g/mol, XLogP of 2.99, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-methyl-2-(pent-4-enoylamino)pentyl] pent-4-enoate is sourced from PubChem (CID 101078959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).