About 2-methylbutyl pent-4-eneperoxoate
2-methylbutyl pent-4-eneperoxoate (PubChem CID 174619834) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methylbutyl pent-4-eneperoxoate.
Molecular Properties
| Compound Name | 2-methylbutyl pent-4-eneperoxoate |
| PubChem CID | 174619834 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-methylbutyl pent-4-eneperoxoate |
| SMILES | C=CCCC(=O)OOCC(C)CC |
| InChI | InChI=1S/C10H18O3/c1-4-6-7-10(11)13-12-8-9(3)5-2/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | JQWDPWVJJOUGJX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl pent-4-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl pent-4-eneperoxoate?
The IUPAC name of 2-methylbutyl pent-4-eneperoxoate (CID 174619834) is 2-methylbutyl pent-4-eneperoxoate.
What is the SMILES notation for 2-methylbutyl pent-4-eneperoxoate?
The canonical SMILES for 2-methylbutyl pent-4-eneperoxoate is C=CCCC(=O)OOCC(C)CC.
What is the InChIKey of 2-methylbutyl pent-4-eneperoxoate?
The InChIKey is JQWDPWVJJOUGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-6-7-10(11)13-12-8-9(3)5-2/h4,9H,1,5-8H2,2-3H3.
What are the key properties of 2-methylbutyl pent-4-eneperoxoate?
2-methylbutyl pent-4-eneperoxoate has a molecular weight of 186.25 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl pent-4-eneperoxoate is sourced from PubChem (CID 174619834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).