About prop-2-enyl decaneperoxoate
prop-2-enyl decaneperoxoate (PubChem CID 150777769) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is prop-2-enyl decaneperoxoate.
Molecular Properties
| Compound Name | prop-2-enyl decaneperoxoate |
| PubChem CID | 150777769 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | prop-2-enyl decaneperoxoate |
| SMILES | C=CCOOC(=O)CCCCCCCCC |
| InChI | InChI=1S/C13H24O3/c1-3-5-6-7-8-9-10-11-13(14)16-15-12-4-2/h4H,2-3,5-12H2,1H3 |
| InChIKey | KBFIMBKFOPEVPA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl decaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl decaneperoxoate?
The IUPAC name of prop-2-enyl decaneperoxoate (CID 150777769) is prop-2-enyl decaneperoxoate.
What is the SMILES notation for prop-2-enyl decaneperoxoate?
The canonical SMILES for prop-2-enyl decaneperoxoate is C=CCOOC(=O)CCCCCCCCC.
What is the InChIKey of prop-2-enyl decaneperoxoate?
The InChIKey is KBFIMBKFOPEVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-3-5-6-7-8-9-10-11-13(14)16-15-12-4-2/h4H,2-3,5-12H2,1H3.
What are the key properties of prop-2-enyl decaneperoxoate?
prop-2-enyl decaneperoxoate has a molecular weight of 228.33 g/mol, XLogP of 3.79, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl decaneperoxoate is sourced from PubChem (CID 150777769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).