About [(E)-oct-2-enyl] hexaneperoxoate
[(E)-oct-2-enyl] hexaneperoxoate (PubChem CID 175496356) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is [(E)-oct-2-enyl] hexaneperoxoate.
Molecular Properties
| Compound Name | [(E)-oct-2-enyl] hexaneperoxoate |
| PubChem CID | 175496356 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | [(E)-oct-2-enyl] hexaneperoxoate |
| SMILES | CCCCC/C=C/COOC(=O)CCCCC |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-8-9-11-13-16-17-14(15)12-10-6-4-2/h9,11H,3-8,10,12-13H2,1-2H3/b11-9+ |
| InChIKey | YKPWXQCPYFHIJV-PKNBQFBNSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [(E)-oct-2-enyl] hexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-oct-2-enyl] hexaneperoxoate?
The IUPAC name of [(E)-oct-2-enyl] hexaneperoxoate (CID 175496356) is [(E)-oct-2-enyl] hexaneperoxoate.
What is the SMILES notation for [(E)-oct-2-enyl] hexaneperoxoate?
The canonical SMILES for [(E)-oct-2-enyl] hexaneperoxoate is CCCCC/C=C/COOC(=O)CCCCC.
What is the InChIKey of [(E)-oct-2-enyl] hexaneperoxoate?
The InChIKey is YKPWXQCPYFHIJV-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H26O3/c1-3-5-7-8-9-11-13-16-17-14(15)12-10-6-4-2/h9,11H,3-8,10,12-13H2,1-2H3/b11-9+.
What are the key properties of [(E)-oct-2-enyl] hexaneperoxoate?
[(E)-oct-2-enyl] hexaneperoxoate has a molecular weight of 242.36 g/mol, XLogP of 4.18, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-oct-2-enyl] hexaneperoxoate is sourced from PubChem (CID 175496356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).