C8H16N2O — CID 104872907
N-[(2R)-1-aminopropan-2-yl]pent-4-enamide (PubChem CID 104872907) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N-[(2R)-1-aminopropan-2-yl]pent-4-enamide.
| Compound Name | N-[(2R)-1-aminopropan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 104872907 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N-[(2R)-1-aminopropan-2-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)N[C@H](C)CN |
| InChI | InChI=1S/C8H16N2O/c1-3-4-5-8(11)10-7(2)6-9/h3,7H,1,4-6,9H2,2H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | MGCBZWGVOOEJQJ-SSDOTTSWSA-N |
| XLogP | 0.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|