C11H19NO5 — CID 146471608
(2S)-3-[(2S)-2-hydroxypropoxy]-2-(pent-4-enoylamino)propanoic acid (PubChem CID 146471608) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (2S)-3-[(2S)-2-hydroxypropoxy]-2-(pent-4-enoylamino)propanoic acid.
| Compound Name | (2S)-3-[(2S)-2-hydroxypropoxy]-2-(pent-4-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 146471608 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (2S)-3-[(2S)-2-hydroxypropoxy]-2-(pent-4-enoylamino)propanoic acid |
| SMILES | C=CCCC(=O)N[C@@H](COC[C@H](C)O)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c1-3-4-5-10(14)12-9(11(15)16)7-17-6-8(2)13/h3,8-9,13H,1,4-7H2,2H3,(H,12,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | NZWWTFSHMMYVGD-IUCAKERBSA-N |
| XLogP | -0.08 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|