About 3-oxohept-6-eneperoxoic acid
3-oxohept-6-eneperoxoic acid (PubChem CID 22070798) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 3-oxohept-6-eneperoxoic acid.
Molecular Properties
| Compound Name | 3-oxohept-6-eneperoxoic acid |
| PubChem CID | 22070798 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3-oxohept-6-eneperoxoic acid |
| SMILES | C=CCCC(=O)CC(=O)OO |
| InChI | InChI=1S/C7H10O4/c1-2-3-4-6(8)5-7(9)11-10/h2,10H,1,3-5H2 |
| InChIKey | HNMIDGGRLTXUCF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohept-6-eneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohept-6-eneperoxoic acid?
The IUPAC name of 3-oxohept-6-eneperoxoic acid (CID 22070798) is 3-oxohept-6-eneperoxoic acid.
What is the SMILES notation for 3-oxohept-6-eneperoxoic acid?
The canonical SMILES for 3-oxohept-6-eneperoxoic acid is C=CCCC(=O)CC(=O)OO.
What is the InChIKey of 3-oxohept-6-eneperoxoic acid?
The InChIKey is HNMIDGGRLTXUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-2-3-4-6(8)5-7(9)11-10/h2,10H,1,3-5H2.
What are the key properties of 3-oxohept-6-eneperoxoic acid?
3-oxohept-6-eneperoxoic acid has a molecular weight of 158.15 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohept-6-eneperoxoic acid is sourced from PubChem (CID 22070798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).