C23H25F5O6 — CID 132538961
[2-(hex-5-enoyloxymethyl)-2-methyl-3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl] hex-5-enoate (PubChem CID 132538961) has the molecular formula C23H25F5O6 and a molecular weight of 492.44 g/mol. Its IUPAC name is [2-(hex-5-enoyloxymethyl)-2-methyl-3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl] hex-5-enoate.
| Compound Name | [2-(hex-5-enoyloxymethyl)-2-methyl-3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl] hex-5-enoate |
|---|---|
| PubChem CID | 132538961 |
| Molecular Formula | C23H25F5O6 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [2-(hex-5-enoyloxymethyl)-2-methyl-3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)OCC(C)(COC(=O)CCCC=C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H25F5O6/c1-4-6-8-10-14(29)32-12-23(3,13-33-15(30)11-9-7-5-2)22(31)34-21-19(27)17(25)16(24)18(26)20(21)28/h4-5H,1-2,6-13H2,3H3 |
| InChIKey | DEBKQDVZGQOMCK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|