About thiophen-2-yl pent-4-enoate
thiophen-2-yl pent-4-enoate (PubChem CID 174368768) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is thiophen-2-yl pent-4-enoate.
Molecular Properties
| Compound Name | thiophen-2-yl pent-4-enoate |
| PubChem CID | 174368768 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | thiophen-2-yl pent-4-enoate |
| SMILES | C=CCCC(=O)Oc1cccs1 |
| InChI | InChI=1S/C9H10O2S/c1-2-3-5-8(10)11-9-6-4-7-12-9/h2,4,6-7H,1,3,5H2 |
| InChIKey | DSMHIJBLQWYNIC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze thiophen-2-yl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-yl pent-4-enoate?
The IUPAC name of thiophen-2-yl pent-4-enoate (CID 174368768) is thiophen-2-yl pent-4-enoate.
What is the SMILES notation for thiophen-2-yl pent-4-enoate?
The canonical SMILES for thiophen-2-yl pent-4-enoate is C=CCCC(=O)Oc1cccs1.
What is the InChIKey of thiophen-2-yl pent-4-enoate?
The InChIKey is DSMHIJBLQWYNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-2-3-5-8(10)11-9-6-4-7-12-9/h2,4,6-7H,1,3,5H2.
What are the key properties of thiophen-2-yl pent-4-enoate?
thiophen-2-yl pent-4-enoate has a molecular weight of 182.24 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-yl pent-4-enoate is sourced from PubChem (CID 174368768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).