About CID 160726441
CID 160726441 (PubChem CID 160726441) has the molecular formula C6H6NaO3S
and a molecular weight of 181.17 g/mol.
Molecular Properties
| Compound Name | CID 160726441 |
| PubChem CID | 160726441 |
| Molecular Formula | C6H6NaO3S |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 180.99 |
| IUPAC Name | — |
| SMILES | O=C(CO)Oc1cccs1.[Na] |
| InChI | InChI=1S/C6H6O3S.Na/c7-4-5(8)9-6-2-1-3-10-6;/h1-3,7H,4H2; |
| InChIKey | RTTVWPMGKSXOPD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 160726441 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160726441?
The IUPAC name of CID 160726441 (CID 160726441) is not available.
What is the SMILES notation for CID 160726441?
The canonical SMILES for CID 160726441 is O=C(CO)Oc1cccs1.[Na].
What is the InChIKey of CID 160726441?
The InChIKey is RTTVWPMGKSXOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.Na/c7-4-5(8)9-6-2-1-3-10-6;/h1-3,7H,4H2;.
What are the key properties of CID 160726441?
CID 160726441 has a molecular weight of 181.17 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160726441 is sourced from PubChem (CID 160726441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).