C7H10O3S — CID 13088133
3-thiophen-2-yloxypropane-1,2-diol (PubChem CID 13088133) has the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. Its IUPAC name is 3-thiophen-2-yloxypropane-1,2-diol.
| Compound Name | 3-thiophen-2-yloxypropane-1,2-diol |
|---|---|
| PubChem CID | 13088133 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 3-thiophen-2-yloxypropane-1,2-diol |
| SMILES | OCC(O)COc1cccs1 |
| InChI | InChI=1S/C7H10O3S/c8-4-6(9)5-10-7-2-1-3-11-7/h1-3,6,8-9H,4-5H2 |
| InChIKey | RDHGCRUCFCRVHX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |