C10H14O5S — CID 139951831
2,3-dihydroxypropyl 2-hydroxy-3-thiophen-2-ylpropanoate (PubChem CID 139951831) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-hydroxy-3-thiophen-2-ylpropanoate.
| Compound Name | 2,3-dihydroxypropyl 2-hydroxy-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 139951831 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2,3-dihydroxypropyl 2-hydroxy-3-thiophen-2-ylpropanoate |
| SMILES | O=C(OCC(O)CO)C(O)Cc1cccs1 |
| InChI | InChI=1S/C10H14O5S/c11-5-7(12)6-15-10(14)9(13)4-8-2-1-3-16-8/h1-3,7,9,11-13H,4-6H2 |
| InChIKey | LJLBQABOOFGZBM-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |