About thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate
thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate (PubChem CID 66167892) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate |
| PubChem CID | 66167892 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate |
| SMILES | NCC(O)C(=O)OCc1cccs1 |
| InChI | InChI=1S/C8H11NO3S/c9-4-7(10)8(11)12-5-6-2-1-3-13-6/h1-3,7,10H,4-5,9H2 |
| InChIKey | YXFSEPKNANSSGU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate?
The IUPAC name of thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate (CID 66167892) is thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate.
What is the SMILES notation for thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate?
The canonical SMILES for thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate is NCC(O)C(=O)OCc1cccs1.
What is the InChIKey of thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate?
The InChIKey is YXFSEPKNANSSGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c9-4-7(10)8(11)12-5-6-2-1-3-13-6/h1-3,7,10H,4-5,9H2.
What are the key properties of thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate?
thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate has a molecular weight of 201.25 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl 3-amino-2-hydroxypropanoate is sourced from PubChem (CID 66167892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).