C17H16O3 — CID 139994732
3-anthracen-9-yloxypropane-1,2-diol (PubChem CID 139994732) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-anthracen-9-yloxypropane-1,2-diol.
| Compound Name | 3-anthracen-9-yloxypropane-1,2-diol |
|---|---|
| PubChem CID | 139994732 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-anthracen-9-yloxypropane-1,2-diol |
| SMILES | OCC(O)COc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C17H16O3/c18-10-14(19)11-20-17-15-7-3-1-5-12(15)9-13-6-2-4-8-16(13)17/h1-9,14,18-19H,10-11H2 |
| InChIKey | HVYIMCVFCCJXNR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|