About boric acid;9-ethoxyanthracene
boric acid;9-ethoxyanthracene (PubChem CID 175362289) has the molecular formula C16H17BO4
and a molecular weight of 284.12 g/mol. Its IUPAC name is boric acid;9-ethoxyanthracene.
Molecular Properties
| Compound Name | boric acid;9-ethoxyanthracene |
| PubChem CID | 175362289 |
| Molecular Formula | C16H17BO4 |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | boric acid;9-ethoxyanthracene |
| SMILES | CCOc1c2ccccc2cc2ccccc12.OB(O)O |
| InChI | InChI=1S/C16H14O.BH3O3/c1-2-17-16-14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)16;2-1(3)4/h3-11H,2H2,1H3;2-4H |
| InChIKey | FXMDGGTUSOQKDM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze boric acid;9-ethoxyanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;9-ethoxyanthracene?
The IUPAC name of boric acid;9-ethoxyanthracene (CID 175362289) is boric acid;9-ethoxyanthracene.
What is the SMILES notation for boric acid;9-ethoxyanthracene?
The canonical SMILES for boric acid;9-ethoxyanthracene is CCOc1c2ccccc2cc2ccccc12.OB(O)O.
What is the InChIKey of boric acid;9-ethoxyanthracene?
The InChIKey is FXMDGGTUSOQKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.BH3O3/c1-2-17-16-14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)16;2-1(3)4/h3-11H,2H2,1H3;2-4H.
What are the key properties of boric acid;9-ethoxyanthracene?
boric acid;9-ethoxyanthracene has a molecular weight of 284.12 g/mol, XLogP of 2.34, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;9-ethoxyanthracene is sourced from PubChem (CID 175362289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).