About diethoxy(methyl)silane;9-methoxyanthracene
diethoxy(methyl)silane;9-methoxyanthracene (PubChem CID 173160336) has the molecular formula C20H26O3Si
and a molecular weight of 342.51 g/mol. Its IUPAC name is diethoxy(methyl)silane;9-methoxyanthracene.
Molecular Properties
| Compound Name | diethoxy(methyl)silane;9-methoxyanthracene |
| PubChem CID | 173160336 |
| Molecular Formula | C20H26O3Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | diethoxy(methyl)silane;9-methoxyanthracene |
| SMILES | CCO[SiH](C)OCC.COc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C15H12O.C5H14O2Si/c1-16-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15;1-4-6-8(3)7-5-2/h2-10H,1H3;8H,4-5H2,1-3H3 |
| InChIKey | RKOFPSHAEFGKNT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(methyl)silane;9-methoxyanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(methyl)silane;9-methoxyanthracene?
The IUPAC name of diethoxy(methyl)silane;9-methoxyanthracene (CID 173160336) is diethoxy(methyl)silane;9-methoxyanthracene.
What is the SMILES notation for diethoxy(methyl)silane;9-methoxyanthracene?
The canonical SMILES for diethoxy(methyl)silane;9-methoxyanthracene is CCO[SiH](C)OCC.COc1c2ccccc2cc2ccccc12.
What is the InChIKey of diethoxy(methyl)silane;9-methoxyanthracene?
The InChIKey is RKOFPSHAEFGKNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O.C5H14O2Si/c1-16-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15;1-4-6-8(3)7-5-2/h2-10H,1H3;8H,4-5H2,1-3H3.
What are the key properties of diethoxy(methyl)silane;9-methoxyanthracene?
diethoxy(methyl)silane;9-methoxyanthracene has a molecular weight of 342.51 g/mol, XLogP of 4.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(methyl)silane;9-methoxyanthracene is sourced from PubChem (CID 173160336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).