C9H14O6S — CID 126740844
2-hydroxy-2-thiophen-2-ylacetic acid;propane-1,2,3-triol (PubChem CID 126740844) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-hydroxy-2-thiophen-2-ylacetic acid;propane-1,2,3-triol.
| Compound Name | 2-hydroxy-2-thiophen-2-ylacetic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 126740844 |
| Molecular Formula | C9H14O6S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-hydroxy-2-thiophen-2-ylacetic acid;propane-1,2,3-triol |
| SMILES | O=C(O)C(O)c1cccs1.OCC(O)CO |
| InChI | InChI=1S/C6H6O3S.C3H8O3/c7-5(6(8)9)4-2-1-3-10-4;4-1-3(6)2-5/h1-3,5,7H,(H,8,9);3-6H,1-2H2 |
| InChIKey | UNHYTFUXWUZSHY-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |