C10H8O2S2 — CID 725360
(2R)-2-hydroxy-1,2-dithiophen-2-ylethanone (PubChem CID 725360) has the molecular formula C10H8O2S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (2R)-2-hydroxy-1,2-dithiophen-2-ylethanone.
| Compound Name | (2R)-2-hydroxy-1,2-dithiophen-2-ylethanone |
|---|---|
| PubChem CID | 725360 |
| Molecular Formula | C10H8O2S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (2R)-2-hydroxy-1,2-dithiophen-2-ylethanone |
| SMILES | O=C(c1cccs1)[C@@H](O)c1cccs1 |
| InChI | InChI=1S/C10H8O2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H/t9-/m0/s1 |
| InChIKey | OGWZIOZTPNLTCR-VIFPVBQESA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |