C14H14O2S2 — CID 132603517
2-propyl-1,3-dithiophen-2-ylpropane-1,3-dione (PubChem CID 132603517) has the molecular formula C14H14O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-propyl-1,3-dithiophen-2-ylpropane-1,3-dione.
| Compound Name | 2-propyl-1,3-dithiophen-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 132603517 |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-propyl-1,3-dithiophen-2-ylpropane-1,3-dione |
| SMILES | CCCC(C(=O)c1cccs1)C(=O)c1cccs1 |
| InChI | InChI=1S/C14H14O2S2/c1-2-5-10(13(15)11-6-3-8-17-11)14(16)12-7-4-9-18-12/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | XNCDRYNEMUDIDA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|