C20H26O2S2 — CID 3628681
2,3-dibutyl-1,4-dithiophen-2-ylbutane-1,4-dione (PubChem CID 3628681) has the molecular formula C20H26O2S2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 2,3-dibutyl-1,4-dithiophen-2-ylbutane-1,4-dione.
| Compound Name | 2,3-dibutyl-1,4-dithiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 3628681 |
| Molecular Formula | C20H26O2S2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2,3-dibutyl-1,4-dithiophen-2-ylbutane-1,4-dione |
| SMILES | CCCCC(C(=O)c1cccs1)C(CCCC)C(=O)c1cccs1 |
| InChI | InChI=1S/C20H26O2S2/c1-3-5-9-15(19(21)17-11-7-13-23-17)16(10-6-4-2)20(22)18-12-8-14-24-18/h7-8,11-16H,3-6,9-10H2,1-2H3 |
| InChIKey | JLKDAEGFZSFYSV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |