C15H22O2S — CID 61333341
2-methyl-1-thiophen-2-yldecane-1,3-dione (PubChem CID 61333341) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-methyl-1-thiophen-2-yldecane-1,3-dione.
| Compound Name | 2-methyl-1-thiophen-2-yldecane-1,3-dione |
|---|---|
| PubChem CID | 61333341 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-methyl-1-thiophen-2-yldecane-1,3-dione |
| SMILES | CCCCCCCC(=O)C(C)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H22O2S/c1-3-4-5-6-7-9-13(16)12(2)15(17)14-10-8-11-18-14/h8,10-12H,3-7,9H2,1-2H3 |
| InChIKey | PGYARYDCBFPVAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|