C6H8ClNO2S — CID 69120250
2-amino-2-thiophen-2-ylacetic acid;hydrochloride (PubChem CID 69120250) has the molecular formula C6H8ClNO2S and a molecular weight of 193.66 g/mol. Its IUPAC name is 2-amino-2-thiophen-2-ylacetic acid;hydrochloride.
| Compound Name | 2-amino-2-thiophen-2-ylacetic acid;hydrochloride |
|---|---|
| PubChem CID | 69120250 |
| Molecular Formula | C6H8ClNO2S |
| Molecular Weight | 193.66 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 2-amino-2-thiophen-2-ylacetic acid;hydrochloride |
| SMILES | Cl.NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C6H7NO2S.ClH/c7-5(6(8)9)4-2-1-3-10-4;/h1-3,5H,7H2,(H,8,9);1H |
| InChIKey | PZUJOPZKYOFXEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |