C11H16N2O3S — CID 115286900
(2S)-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbutanoic acid (PubChem CID 115286900) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115286900 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2S)-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(N)c1cccs1)C(=O)O |
| InChI | InChI=1S/C11H16N2O3S/c1-6(2)9(11(15)16)13-10(14)8(12)7-4-3-5-17-7/h3-6,8-9H,12H2,1-2H3,(H,13,14)(H,15,16)/t8?,9-/m0/s1 |
| InChIKey | LLCRDRPVEZRJAW-GKAPJAKFSA-N |
| XLogP | 0.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |