C10H13N3O4S — CID 114005146
(2R)-4-amino-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-4-oxobutanoic acid (PubChem CID 114005146) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is (2R)-4-amino-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 114005146 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2R)-4-amino-2-[(2-amino-2-thiophen-2-ylacetyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)C(N)c1cccs1)C(=O)O |
| InChI | InChI=1S/C10H13N3O4S/c11-7(14)4-5(10(16)17)13-9(15)8(12)6-2-1-3-18-6/h1-3,5,8H,4,12H2,(H2,11,14)(H,13,15)(H,16,17)/t5-,8?/m1/s1 |
| InChIKey | CXJXCDAAKXDMHO-RUQIKYNFSA-N |
| XLogP | -0.81 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |