C10H14N4O3S — CID 113279235
2-amino-N,N-bis(2-amino-2-oxoethyl)-2-thiophen-2-ylacetamide (PubChem CID 113279235) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-amino-2-oxoethyl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113279235 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-2-thiophen-2-ylacetamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)C(N)c1cccs1 |
| InChI | InChI=1S/C10H14N4O3S/c11-7(15)4-14(5-8(12)16)10(17)9(13)6-2-1-3-18-6/h1-3,9H,4-5,13H2,(H2,11,15)(H2,12,16) |
| InChIKey | UEEYWNUPCYEQRZ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |