C9H12N2O3S — CID 115286833
2-[(2-amino-2-thiophen-2-ylacetyl)-methylamino]acetic acid (PubChem CID 115286833) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-[(2-amino-2-thiophen-2-ylacetyl)-methylamino]acetic acid.
| Compound Name | 2-[(2-amino-2-thiophen-2-ylacetyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 115286833 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-[(2-amino-2-thiophen-2-ylacetyl)-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C(N)c1cccs1 |
| InChI | InChI=1S/C9H12N2O3S/c1-11(5-7(12)13)9(14)8(10)6-3-2-4-15-6/h2-4,8H,5,10H2,1H3,(H,12,13) |
| InChIKey | HNFWZPGLVGXEKW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |