C7H10O3S — CID 59769549
1-thiophen-2-ylpropane-1,2,3-triol (PubChem CID 59769549) has the molecular formula C7H10O3S and a molecular weight of 174.22 g/mol. Its IUPAC name is 1-thiophen-2-ylpropane-1,2,3-triol.
| Compound Name | 1-thiophen-2-ylpropane-1,2,3-triol |
|---|---|
| PubChem CID | 59769549 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 1-thiophen-2-ylpropane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cccs1 |
| InChI | InChI=1S/C7H10O3S/c8-4-5(9)7(10)6-2-1-3-11-6/h1-3,5,7-10H,4H2 |
| InChIKey | XBZUWLXXDYOLEP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |