C11H18O2S — CID 103459851
3-ethyl-1-thiophen-2-ylpentane-1,2-diol (PubChem CID 103459851) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 3-ethyl-1-thiophen-2-ylpentane-1,2-diol.
| Compound Name | 3-ethyl-1-thiophen-2-ylpentane-1,2-diol |
|---|---|
| PubChem CID | 103459851 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-ethyl-1-thiophen-2-ylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1cccs1 |
| InChI | InChI=1S/C11H18O2S/c1-3-8(4-2)10(12)11(13)9-6-5-7-14-9/h5-8,10-13H,3-4H2,1-2H3 |
| InChIKey | MPUORQIQYAHJDD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |