C12H20O2S — CID 116713377
2-ethoxy-3,3-dimethyl-1-thiophen-2-ylbutan-1-ol (PubChem CID 116713377) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-thiophen-2-ylbutan-1-ol.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 116713377 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-thiophen-2-ylbutan-1-ol |
| SMILES | CCOC(C(O)c1cccs1)C(C)(C)C |
| InChI | InChI=1S/C12H20O2S/c1-5-14-11(12(2,3)4)10(13)9-7-6-8-15-9/h6-8,10-11,13H,5H2,1-4H3 |
| InChIKey | IMKQLGWIOSLDIR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |