C12H19ClO2S — CID 107359632
1-(3-chlorothiophen-2-yl)-2-ethoxy-3,3-dimethylbutan-1-ol (PubChem CID 107359632) has the molecular formula C12H19ClO2S and a molecular weight of 262.80 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-ethoxy-3,3-dimethylbutan-1-ol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-ethoxy-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 107359632 |
| Molecular Formula | C12H19ClO2S |
| Molecular Weight | 262.80 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-ethoxy-3,3-dimethylbutan-1-ol |
| SMILES | CCOC(C(O)c1sccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C12H19ClO2S/c1-5-15-11(12(2,3)4)9(14)10-8(13)6-7-16-10/h6-7,9,11,14H,5H2,1-4H3 |
| InChIKey | WYRRMFDWHUMOCX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |