C15H16Cl2O3S — CID 80644143
(2-chloro-4,5-diethoxyphenyl)-(3-chlorothiophen-2-yl)methanol (PubChem CID 80644143) has the molecular formula C15H16Cl2O3S and a molecular weight of 347.26 g/mol. Its IUPAC name is (2-chloro-4,5-diethoxyphenyl)-(3-chlorothiophen-2-yl)methanol.
| Compound Name | (2-chloro-4,5-diethoxyphenyl)-(3-chlorothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 80644143 |
| Molecular Formula | C15H16Cl2O3S |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (2-chloro-4,5-diethoxyphenyl)-(3-chlorothiophen-2-yl)methanol |
| SMILES | CCOc1cc(Cl)c(C(O)c2sccc2Cl)cc1OCC |
| InChI | InChI=1S/C15H16Cl2O3S/c1-3-19-12-7-9(11(17)8-13(12)20-4-2)14(18)15-10(16)5-6-21-15/h5-8,14,18H,3-4H2,1-2H3 |
| InChIKey | GPCNVKOFSXNHON-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |