C16H19ClO4 — CID 114822297
(2-chloro-4,5-diethoxyphenyl)-(5-methylfuran-3-yl)methanol (PubChem CID 114822297) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is (2-chloro-4,5-diethoxyphenyl)-(5-methylfuran-3-yl)methanol.
| Compound Name | (2-chloro-4,5-diethoxyphenyl)-(5-methylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 114822297 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2-chloro-4,5-diethoxyphenyl)-(5-methylfuran-3-yl)methanol |
| SMILES | CCOc1cc(Cl)c(C(O)c2coc(C)c2)cc1OCC |
| InChI | InChI=1S/C16H19ClO4/c1-4-19-14-7-12(13(17)8-15(14)20-5-2)16(18)11-6-10(3)21-9-11/h6-9,16,18H,4-5H2,1-3H3 |
| InChIKey | JFWJXHISWOYPTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |