C15H17ClOS — CID 115484530
(2-chloro-4,5-dimethylphenyl)-(3-ethylthiophen-2-yl)methanol (PubChem CID 115484530) has the molecular formula C15H17ClOS and a molecular weight of 280.82 g/mol. Its IUPAC name is (2-chloro-4,5-dimethylphenyl)-(3-ethylthiophen-2-yl)methanol.
| Compound Name | (2-chloro-4,5-dimethylphenyl)-(3-ethylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115484530 |
| Molecular Formula | C15H17ClOS |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2-chloro-4,5-dimethylphenyl)-(3-ethylthiophen-2-yl)methanol |
| SMILES | CCc1ccsc1C(O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C15H17ClOS/c1-4-11-5-6-18-15(11)14(17)12-7-9(2)10(3)8-13(12)16/h5-8,14,17H,4H2,1-3H3 |
| InChIKey | WZRBGCIRDCCAML-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |