C15H17ClS — CID 79975785
2-[chloro-(2,5-dimethylphenyl)methyl]-3-ethylthiophene (PubChem CID 79975785) has the molecular formula C15H17ClS and a molecular weight of 264.82 g/mol. Its IUPAC name is 2-[chloro-(2,5-dimethylphenyl)methyl]-3-ethylthiophene.
| Compound Name | 2-[chloro-(2,5-dimethylphenyl)methyl]-3-ethylthiophene |
|---|---|
| PubChem CID | 79975785 |
| Molecular Formula | C15H17ClS |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[chloro-(2,5-dimethylphenyl)methyl]-3-ethylthiophene |
| SMILES | CCc1ccsc1C(Cl)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H17ClS/c1-4-12-7-8-17-15(12)14(16)13-9-10(2)5-6-11(13)3/h5-9,14H,4H2,1-3H3 |
| InChIKey | FLAPYPHGTHFHSV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|