About (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol
(4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol (PubChem CID 105057093) has the molecular formula C15H17BrO3S
and a molecular weight of 357.27 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol.
Molecular Properties
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol |
| PubChem CID | 105057093 |
| Molecular Formula | C15H17BrO3S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol |
| SMILES | CCc1ccsc1C(O)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C15H17BrO3S/c1-4-9-5-6-20-15(9)14(17)10-7-13(19-3)11(16)8-12(10)18-2/h5-8,14,17H,4H2,1-3H3 |
| InChIKey | DMJAHQHYRCVSMX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol?
The IUPAC name of (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol (CID 105057093) is (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol.
What is the SMILES notation for (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol?
The canonical SMILES for (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol is CCc1ccsc1C(O)c1cc(OC)c(Br)cc1OC.
What is the InChIKey of (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol?
The InChIKey is DMJAHQHYRCVSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrO3S/c1-4-9-5-6-20-15(9)14(17)10-7-13(19-3)11(16)8-12(10)18-2/h5-8,14,17H,4H2,1-3H3.
What are the key properties of (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol?
(4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol has a molecular weight of 357.27 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,5-dimethoxyphenyl)-(3-ethylthiophen-2-yl)methanol is sourced from PubChem (CID 105057093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).