C10H16ClNOS — CID 80642659
2-(aminomethyl)-1-(3-chlorothiophen-2-yl)-3-methylbutan-1-ol (PubChem CID 80642659) has the molecular formula C10H16ClNOS and a molecular weight of 233.76 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(3-chlorothiophen-2-yl)-3-methylbutan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(3-chlorothiophen-2-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 80642659 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(aminomethyl)-1-(3-chlorothiophen-2-yl)-3-methylbutan-1-ol |
| SMILES | CC(C)C(CN)C(O)c1sccc1Cl |
| InChI | InChI=1S/C10H16ClNOS/c1-6(2)7(5-12)9(13)10-8(11)3-4-14-10/h3-4,6-7,9,13H,5,12H2,1-2H3 |
| InChIKey | OJELGZZTJQYUQE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |